C23H24N2O2S — CID 157226633
N-[(3S)-2-oxo-1-(4-phenyl-1,3-thiazol-2-yl)heptan-3-yl]benzamide (PubChem CID 157226633) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[(3S)-2-oxo-1-(4-phenyl-1,3-thiazol-2-yl)heptan-3-yl]benzamide.
| Compound Name | N-[(3S)-2-oxo-1-(4-phenyl-1,3-thiazol-2-yl)heptan-3-yl]benzamide |
|---|---|
| PubChem CID | 157226633 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[(3S)-2-oxo-1-(4-phenyl-1,3-thiazol-2-yl)heptan-3-yl]benzamide |
| SMILES | CCCC[C@H](NC(=O)c1ccccc1)C(=O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H24N2O2S/c1-2-3-14-19(25-23(27)18-12-8-5-9-13-18)21(26)15-22-24-20(16-28-22)17-10-6-4-7-11-17/h4-13,16,19H,2-3,14-15H2,1H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | ATPOAXBCLJYNQM-IBGZPJMESA-N |
| XLogP | 4.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |