C23H23N3O4S — CID 55379937
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-benzamidobutanoate (PubChem CID 55379937) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-benzamidobutanoate.
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55379937 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OC(C)C(=O)Nc1nc(-c2ccccc2)cs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-15(24-22(29)18-11-7-4-8-12-18)13-20(27)30-16(2)21(28)26-23-25-19(14-31-23)17-9-5-3-6-10-17/h3-12,14-16H,13H2,1-2H3,(H,24,29)(H,25,26,28) |
| InChIKey | OBRJCTNZGIYCQA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |