About [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate (PubChem CID 4272348) has the molecular formula C25H21N3O4S
and a molecular weight of 459.53 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate.
Molecular Properties
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate |
| PubChem CID | 4272348 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate |
| SMILES | CC(OC(=O)CNC(=O)c1ccc2ccccc2c1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C25H21N3O4S/c1-16(23(30)28-25-27-21(15-33-25)18-8-3-2-4-9-18)32-22(29)14-26-24(31)20-12-11-17-7-5-6-10-19(17)13-20/h2-13,15-16H,14H2,1H3,(H,26,31)(H,27,28,30) |
| InChIKey | MIBVPQPQHSZTSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate?
The IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate (CID 4272348) is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate.
What is the SMILES notation for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate?
The canonical SMILES for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate is CC(OC(=O)CNC(=O)c1ccc2ccccc2c1)C(=O)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate?
The InChIKey is MIBVPQPQHSZTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O4S/c1-16(23(30)28-25-27-21(15-33-25)18-8-3-2-4-9-18)32-22(29)14-26-24(31)20-12-11-17-7-5-6-10-19(17)13-20/h2-13,15-16H,14H2,1H3,(H,26,31)(H,27,28,30).
What are the key properties of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate?
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate has a molecular weight of 459.53 g/mol, XLogP of 4.26, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 2-(naphthalene-2-carbonylamino)acetate is sourced from PubChem (CID 4272348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).