C16H12Cl2N4OS — CID 39777048
(E)-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 39777048) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is (E)-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 39777048 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (E)-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)Nc2nc(-c3cc(Cl)ccc3Cl)cs2)cn1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c1-22-8-10(7-19-22)2-5-15(23)21-16-20-14(9-24-16)12-6-11(17)3-4-13(12)18/h2-9H,1H3,(H,20,21,23)/b5-2+ |
| InChIKey | BZIJYYBSSGBUMK-GORDUTHDSA-N |
| XLogP | 4.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|