C21H15Cl2N3O3S — CID 30725863
(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 30725863) has the molecular formula C21H15Cl2N3O3S and a molecular weight of 460.34 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 30725863 |
| Molecular Formula | C21H15Cl2N3O3S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc(-c3cc(Cl)ccc3Cl)cs2)ccc1OCC#N |
| InChI | InChI=1S/C21H15Cl2N3O3S/c1-28-19-10-13(2-6-18(19)29-9-8-24)3-7-20(27)26-21-25-17(12-30-21)15-11-14(22)4-5-16(15)23/h2-7,10-12H,9H2,1H3,(H,25,26,27)/b7-3+ |
| InChIKey | PWUMNYREAHKBFT-XVNBXDOJSA-N |
| XLogP | 5.68 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|