C24H21N3O5S — CID 3461741
[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 3461741) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3461741 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)Nc2nc(-c3ccc(C)cc3)cs2)ccc1OCC#N |
| InChI | InChI=1S/C24H21N3O5S/c1-16-3-7-18(8-4-16)19-15-33-24(26-19)27-22(28)14-32-23(29)10-6-17-5-9-20(31-12-11-25)21(13-17)30-2/h3-10,13,15H,12,14H2,1-2H3,(H,26,27,28) |
| InChIKey | JDAWUAJKFCYXKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|