C23H22N2O7S — CID 30434474
[2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 30434474) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 30434474 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)COC(=O)/C=C/c3ccc(O)c(OC)c3)n2)c1 |
| InChI | InChI=1S/C23H22N2O7S/c1-29-15-6-8-19(30-2)16(11-15)17-13-33-23(24-17)25-21(27)12-32-22(28)9-5-14-4-7-18(26)20(10-14)31-3/h4-11,13,26H,12H2,1-3H3,(H,24,25,27)/b9-5+ |
| InChIKey | JUHUBCJYNXBIEX-WEVVVXLNSA-N |
| XLogP | 3.74 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|