C23H19F3N2O5S — CID 41223591
[2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 41223591) has the molecular formula C23H19F3N2O5S and a molecular weight of 492.48 g/mol. Its IUPAC name is [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41223591 |
| Molecular Formula | C23H19F3N2O5S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [2-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)COC(=O)/C=C/c3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C23H19F3N2O5S/c1-31-16-8-9-19(32-2)17(11-16)18-13-34-22(27-18)28-20(29)12-33-21(30)10-5-14-3-6-15(7-4-14)23(24,25)26/h3-11,13H,12H2,1-2H3,(H,27,28,29)/b10-5+ |
| InChIKey | PLFDTLDTFNEBBF-BJMVGYQFSA-N |
| XLogP | 5.04 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|