C22H18F2N2O5S — CID 16525442
[2-[[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 16525442) has the molecular formula C22H18F2N2O5S and a molecular weight of 460.46 g/mol. Its IUPAC name is [2-[[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16525442 |
| Molecular Formula | C22H18F2N2O5S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [2-[[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)Nc2nc(-c3cc(F)ccc3F)cs2)c(OC)c1 |
| InChI | InChI=1S/C22H18F2N2O5S/c1-29-15-6-3-13(19(10-15)30-2)4-8-21(28)31-11-20(27)26-22-25-18(12-32-22)16-9-14(23)5-7-17(16)24/h3-10,12H,11H2,1-2H3,(H,25,26,27)/b8-4+ |
| InChIKey | SIMAKGZHUQEPPU-XBXARRHUSA-N |
| XLogP | 4.30 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|