C15H16F2N2OS — CID 26207795
N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]hexanamide (PubChem CID 26207795) has the molecular formula C15H16F2N2OS and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]hexanamide.
| Compound Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 26207795 |
| Molecular Formula | C15H16F2N2OS |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(-c2cc(F)ccc2F)cs1 |
| InChI | InChI=1S/C15H16F2N2OS/c1-2-3-4-5-14(20)19-15-18-13(9-21-15)11-8-10(16)6-7-12(11)17/h6-9H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | SLDVOXWVVKDMIM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|