C22H18ClN3O3S — CID 18272209
(E)-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 18272209) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is (E)-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18272209 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | (E)-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ncc(Cc3ccc(Cl)cc3)s2)ccc1OCC#N |
| InChI | InChI=1S/C22H18ClN3O3S/c1-28-20-13-16(4-8-19(20)29-11-10-24)5-9-21(27)26-22-25-14-18(30-22)12-15-2-6-17(23)7-3-15/h2-9,13-14H,11-12H2,1H3,(H,25,26,27)/b9-5+ |
| InChIKey | DKZLHFLPMSYBMW-WEVVVXLNSA-N |
| XLogP | 4.95 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|