C22H20FN3O4S — CID 55432975
3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 55432975) has the molecular formula C22H20FN3O4S and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55432975 |
| Molecular Formula | C22H20FN3O4S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ncc(Cc3ccc(F)cc3)s2)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H20FN3O4S/c1-29-19-11-15(4-8-18(19)30-13-20(24)27)5-9-21(28)26-22-25-12-17(31-22)10-14-2-6-16(23)7-3-14/h2-9,11-12H,10,13H2,1H3,(H2,24,27)(H,25,26,28) |
| InChIKey | YHUOMFYBOHTMMG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|