C18H13Cl2N3OS — CID 84560348
(E)-3-(4-aminophenyl)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 84560348) has the molecular formula C18H13Cl2N3OS and a molecular weight of 390.30 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 84560348 |
| Molecular Formula | C18H13Cl2N3OS |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Nc1ccc(/C=C/C(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1 |
| InChI | InChI=1S/C18H13Cl2N3OS/c19-12-4-7-14(15(20)9-12)16-10-25-18(22-16)23-17(24)8-3-11-1-5-13(21)6-2-11/h1-10H,21H2,(H,22,23,24)/b8-3+ |
| InChIKey | WMXAHDHHSAATGD-FPYGCLRLSA-N |
| XLogP | 5.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|