C10H11ClN2S — CID 13405872
4-methyl-3-phenyl-1,3-thiazol-2-imine;hydrochloride (PubChem CID 13405872) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is 4-methyl-3-phenyl-1,3-thiazol-2-imine;hydrochloride.
| Compound Name | 4-methyl-3-phenyl-1,3-thiazol-2-imine;hydrochloride |
|---|---|
| PubChem CID | 13405872 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-methyl-3-phenyl-1,3-thiazol-2-imine;hydrochloride |
| SMILES | Cl.[H]/N=c1\scc(C)n1-c1ccccc1 |
| InChI | InChI=1S/C10H10N2S.ClH/c1-8-7-13-10(11)12(8)9-5-3-2-4-6-9;/h2-7,11H,1H3;1H/b11-10-; |
| InChIKey | LSWKCVRNWGMHDT-GMFCBQQYSA-N |
| XLogP | 2.75 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|