C11H11NS2 — CID 902225
4-methyl-3-(4-methylphenyl)-1,3-thiazole-2-thione (PubChem CID 902225) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-methyl-3-(4-methylphenyl)-1,3-thiazole-2-thione.
| Compound Name | 4-methyl-3-(4-methylphenyl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 902225 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-methyl-3-(4-methylphenyl)-1,3-thiazole-2-thione |
| SMILES | Cc1ccc(-n2c(C)csc2=S)cc1 |
| InChI | InChI=1S/C11H11NS2/c1-8-3-5-10(6-4-8)12-9(2)7-14-11(12)13/h3-7H,1-2H3 |
| InChIKey | GLXOPZNHPDTFMP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|