C17H14N2O5 — CID 91899191
1-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrrole-2,5-diol (PubChem CID 91899191) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrrole-2,5-diol.
| Compound Name | 1-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91899191 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrrole-2,5-diol |
| SMILES | COc1ccc(-n2c(O)cc(-c3ccc([N+](=O)[O-])cc3)c2O)cc1 |
| InChI | InChI=1S/C17H14N2O5/c1-24-14-8-6-12(7-9-14)18-16(20)10-15(17(18)21)11-2-4-13(5-3-11)19(22)23/h2-10,20-21H,1H3 |
| InChIKey | GDJHSMLCKYNFLU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|