C11H10ClNO3 — CID 54573091
3-chloro-1-(4-methoxyphenyl)pyrrole-2,5-diol (PubChem CID 54573091) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is 3-chloro-1-(4-methoxyphenyl)pyrrole-2,5-diol.
| Compound Name | 3-chloro-1-(4-methoxyphenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54573091 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-chloro-1-(4-methoxyphenyl)pyrrole-2,5-diol |
| SMILES | COc1ccc(-n2c(O)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C11H10ClNO3/c1-16-8-4-2-7(3-5-8)13-10(14)6-9(12)11(13)15/h2-6,14-15H,1H3 |
| InChIKey | ZYRSMFRWNSQTAX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |