C26H27FN2OS — CID 166642372
N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 166642372) has the molecular formula C26H27FN2OS and a molecular weight of 434.58 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 166642372 |
| Molecular Formula | C26H27FN2OS |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\C34CC5CC(CC(C5)C3)C4)n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H27FN2OS/c1-30-23-8-2-20(3-9-23)24-16-31-25(29(24)22-6-4-21(27)5-7-22)28-26-13-17-10-18(14-26)12-19(11-17)15-26/h2-9,16-19H,10-15H2,1H3/b28-25- |
| InChIKey | BHDHBEAQJVHRAZ-FVDSYPCUSA-N |
| XLogP | 6.22 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|