C9H6N2O3 — CID 140987274
2-oxo-1,4-benzoxazine-8-carboxamide (PubChem CID 140987274) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 2-oxo-1,4-benzoxazine-8-carboxamide.
| Compound Name | 2-oxo-1,4-benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 140987274 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 2-oxo-1,4-benzoxazine-8-carboxamide |
| SMILES | NC(=O)c1cccc2ncc(=O)oc12 |
| InChI | InChI=1S/C9H6N2O3/c10-9(13)5-2-1-3-6-8(5)14-7(12)4-11-6/h1-4H,(H2,10,13) |
| InChIKey | GREVYIJPTKZRJG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |