C13H10ClNO — CID 14072483
2-(2-chloroethyl)benzo[g][1,3]benzoxazole (PubChem CID 14072483) has the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)benzo[g][1,3]benzoxazole.
| Compound Name | 2-(2-chloroethyl)benzo[g][1,3]benzoxazole |
|---|---|
| PubChem CID | 14072483 |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(2-chloroethyl)benzo[g][1,3]benzoxazole |
| SMILES | ClCCc1nc2ccc3ccccc3c2o1 |
| InChI | InChI=1S/C13H10ClNO/c14-8-7-12-15-11-6-5-9-3-1-2-4-10(9)13(11)16-12/h1-6H,7-8H2 |
| InChIKey | CYUYGUHYHSZXGJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|