C18H12ClNO2 — CID 174961597
4-[2-(chloromethyl)benzo[g][1,3]benzoxazol-5-yl]phenol (PubChem CID 174961597) has the molecular formula C18H12ClNO2 and a molecular weight of 309.75 g/mol. Its IUPAC name is 4-[2-(chloromethyl)benzo[g][1,3]benzoxazol-5-yl]phenol.
| Compound Name | 4-[2-(chloromethyl)benzo[g][1,3]benzoxazol-5-yl]phenol |
|---|---|
| PubChem CID | 174961597 |
| Molecular Formula | C18H12ClNO2 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-[2-(chloromethyl)benzo[g][1,3]benzoxazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2cc3nc(CCl)oc3c3ccccc23)cc1 |
| InChI | InChI=1S/C18H12ClNO2/c19-10-17-20-16-9-15(11-5-7-12(21)8-6-11)13-3-1-2-4-14(13)18(16)22-17/h1-9,21H,10H2 |
| InChIKey | LPDOJNHKKRCAPI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|