C9H7BrClNO — CID 130769397
7-(bromomethyl)-2-(chloromethyl)-1,3-benzoxazole (PubChem CID 130769397) has the molecular formula C9H7BrClNO and a molecular weight of 260.52 g/mol. Its IUPAC name is 7-(bromomethyl)-2-(chloromethyl)-1,3-benzoxazole.
| Compound Name | 7-(bromomethyl)-2-(chloromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 130769397 |
| Molecular Formula | C9H7BrClNO |
| Molecular Weight | 260.52 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 7-(bromomethyl)-2-(chloromethyl)-1,3-benzoxazole |
| SMILES | ClCc1nc2cccc(CBr)c2o1 |
| InChI | InChI=1S/C9H7BrClNO/c10-4-6-2-1-3-7-9(6)13-8(5-11)12-7/h1-3H,4-5H2 |
| InChIKey | WLVVGIRIWFYXAR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|