C10H9N3O — CID 131012085
2-[7-(aminomethyl)-1,3-benzoxazol-2-yl]acetonitrile (PubChem CID 131012085) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-[7-(aminomethyl)-1,3-benzoxazol-2-yl]acetonitrile.
| Compound Name | 2-[7-(aminomethyl)-1,3-benzoxazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 131012085 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-[7-(aminomethyl)-1,3-benzoxazol-2-yl]acetonitrile |
| SMILES | N#CCc1nc2cccc(CN)c2o1 |
| InChI | InChI=1S/C10H9N3O/c11-5-4-9-13-8-3-1-2-7(6-12)10(8)14-9/h1-3H,4,6,12H2 |
| InChIKey | YSCJSHAFTRSDFG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |