C11H10N2O — CID 130784394
2-(4-ethyl-1,3-benzoxazol-2-yl)acetonitrile (PubChem CID 130784394) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(4-ethyl-1,3-benzoxazol-2-yl)acetonitrile.
| Compound Name | 2-(4-ethyl-1,3-benzoxazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 130784394 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(4-ethyl-1,3-benzoxazol-2-yl)acetonitrile |
| SMILES | CCc1cccc2oc(CC#N)nc12 |
| InChI | InChI=1S/C11H10N2O/c1-2-8-4-3-5-9-11(8)13-10(14-9)6-7-12/h3-5H,2,6H2,1H3 |
| InChIKey | NNVZZUQJFYZTTK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |