C13H17NO — CID 174743684
4-butyl-2-ethyl-1,3-benzoxazole (PubChem CID 174743684) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-butyl-2-ethyl-1,3-benzoxazole.
| Compound Name | 4-butyl-2-ethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 174743684 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-butyl-2-ethyl-1,3-benzoxazole |
| SMILES | CCCCc1cccc2oc(CC)nc12 |
| InChI | InChI=1S/C13H17NO/c1-3-5-7-10-8-6-9-11-13(10)14-12(4-2)15-11/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | HEMFVKUUOGPMEQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |