C14H17NO — CID 174821768
4-ethenyl-2-pentyl-1,3-benzoxazole (PubChem CID 174821768) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-ethenyl-2-pentyl-1,3-benzoxazole.
| Compound Name | 4-ethenyl-2-pentyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 174821768 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4-ethenyl-2-pentyl-1,3-benzoxazole |
| SMILES | C=Cc1cccc2oc(CCCCC)nc12 |
| InChI | InChI=1S/C14H17NO/c1-3-5-6-10-13-15-14-11(4-2)8-7-9-12(14)16-13/h4,7-9H,2-3,5-6,10H2,1H3 |
| InChIKey | HRMIQURXLCXWTF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|