About 4-azido-2-butyl-1,3-benzoxazole
4-azido-2-butyl-1,3-benzoxazole (PubChem CID 169325793) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-azido-2-butyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 4-azido-2-butyl-1,3-benzoxazole |
| PubChem CID | 169325793 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-azido-2-butyl-1,3-benzoxazole |
| SMILES | CCCCc1nc2c(N=[N+]=[N-])cccc2o1 |
| InChI | InChI=1S/C11H12N4O/c1-2-3-7-10-13-11-8(14-15-12)5-4-6-9(11)16-10/h4-6H,2-3,7H2,1H3 |
| InChIKey | AGHGYVQMSVGJQQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-2-butyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-2-butyl-1,3-benzoxazole?
The IUPAC name of 4-azido-2-butyl-1,3-benzoxazole (CID 169325793) is 4-azido-2-butyl-1,3-benzoxazole.
What is the SMILES notation for 4-azido-2-butyl-1,3-benzoxazole?
The canonical SMILES for 4-azido-2-butyl-1,3-benzoxazole is CCCCc1nc2c(N=[N+]=[N-])cccc2o1.
What is the InChIKey of 4-azido-2-butyl-1,3-benzoxazole?
The InChIKey is AGHGYVQMSVGJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O/c1-2-3-7-10-13-11-8(14-15-12)5-4-6-9(11)16-10/h4-6H,2-3,7H2,1H3.
What are the key properties of 4-azido-2-butyl-1,3-benzoxazole?
4-azido-2-butyl-1,3-benzoxazole has a molecular weight of 216.24 g/mol, XLogP of 4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-2-butyl-1,3-benzoxazole is sourced from PubChem (CID 169325793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).