C11H13NO — CID 67428244
7-butyl-2,1-benzoxazole (PubChem CID 67428244) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-butyl-2,1-benzoxazole.
| Compound Name | 7-butyl-2,1-benzoxazole |
|---|---|
| PubChem CID | 67428244 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-butyl-2,1-benzoxazole |
| SMILES | CCCCc1cccc2conc12 |
| InChI | InChI=1S/C11H13NO/c1-2-3-5-9-6-4-7-10-8-13-12-11(9)10/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | HUCXIDIVGIUZNZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |