C10H10ClNO3S — CID 84709935
2-(2-methyl-1,3-benzoxazol-4-yl)ethanesulfonyl chloride (PubChem CID 84709935) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzoxazol-4-yl)ethanesulfonyl chloride.
| Compound Name | 2-(2-methyl-1,3-benzoxazol-4-yl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 84709935 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-(2-methyl-1,3-benzoxazol-4-yl)ethanesulfonyl chloride |
| SMILES | Cc1nc2c(CCS(=O)(=O)Cl)cccc2o1 |
| InChI | InChI=1S/C10H10ClNO3S/c1-7-12-10-8(5-6-16(11,13)14)3-2-4-9(10)15-7/h2-4H,5-6H2,1H3 |
| InChIKey | GTNMCVVCFMYFEL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |