C14H14N2O2 — CID 118211284
2-[(dimethylamino)methyl]benzo[g][1,3]benzoxazol-5-ol (PubChem CID 118211284) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]benzo[g][1,3]benzoxazol-5-ol.
| Compound Name | 2-[(dimethylamino)methyl]benzo[g][1,3]benzoxazol-5-ol |
|---|---|
| PubChem CID | 118211284 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[(dimethylamino)methyl]benzo[g][1,3]benzoxazol-5-ol |
| SMILES | CN(C)Cc1nc2cc(O)c3ccccc3c2o1 |
| InChI | InChI=1S/C14H14N2O2/c1-16(2)8-13-15-11-7-12(17)9-5-3-4-6-10(9)14(11)18-13/h3-7,17H,8H2,1-2H3 |
| InChIKey | LZINTFPYDLKHHJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |