About chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate
chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate (PubChem CID 160842200) has the molecular formula C15H23N2O7P
and a molecular weight of 374.33 g/mol. Its IUPAC name is chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate |
| PubChem CID | 160842200 |
| Molecular Formula | C15H23N2O7P |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate |
| SMILES | CN.CNC(=O)CCCOP(=O)(O)O.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C5H12NO5P.CH5N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-6-5(7)3-2-4-11-12(8,9)10;1-2/h1-6H;2-4H2,1H3,(H,6,7)(H2,8,9,10);2H2,1H3 |
| InChIKey | SIEFWPDYFLLYAT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate?
The IUPAC name of chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate (CID 160842200) is chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate.
What is the SMILES notation for chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate?
The canonical SMILES for chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate is CN.CNC(=O)CCCOP(=O)(O)O.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate?
The InChIKey is SIEFWPDYFLLYAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C5H12NO5P.CH5N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-6-5(7)3-2-4-11-12(8,9)10;1-2/h1-6H;2-4H2,1H3,(H,6,7)(H2,8,9,10);2H2,1H3.
What are the key properties of chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate?
chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate has a molecular weight of 374.33 g/mol, XLogP of 0.99, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;methanamine;[4-(methylamino)-4-oxobutyl] dihydrogen phosphate is sourced from PubChem (CID 160842200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).