C13H14NO8P — CID 139325470
(2-oxochromen-3-yl)methyl N-(2-phosphonooxyethyl)carbamate (PubChem CID 139325470) has the molecular formula C13H14NO8P and a molecular weight of 343.23 g/mol. Its IUPAC name is (2-oxochromen-3-yl)methyl N-(2-phosphonooxyethyl)carbamate.
| Compound Name | (2-oxochromen-3-yl)methyl N-(2-phosphonooxyethyl)carbamate |
|---|---|
| PubChem CID | 139325470 |
| Molecular Formula | C13H14NO8P |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (2-oxochromen-3-yl)methyl N-(2-phosphonooxyethyl)carbamate |
| SMILES | O=C(NCCOP(=O)(O)O)OCc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H14NO8P/c15-12-10(7-9-3-1-2-4-11(9)22-12)8-20-13(16)14-5-6-21-23(17,18)19/h1-4,7H,5-6,8H2,(H,14,16)(H2,17,18,19) |
| InChIKey | SLPYFIGKKJJEIO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|