C14H16N4O3S — CID 139325148
O-[(2-oxochromen-3-yl)methyl] N-[2-(diaminomethylideneamino)ethyl]carbamothioate (PubChem CID 139325148) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is O-[(2-oxochromen-3-yl)methyl] N-[2-(diaminomethylideneamino)ethyl]carbamothioate.
| Compound Name | O-[(2-oxochromen-3-yl)methyl] N-[2-(diaminomethylideneamino)ethyl]carbamothioate |
|---|---|
| PubChem CID | 139325148 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | O-[(2-oxochromen-3-yl)methyl] N-[2-(diaminomethylideneamino)ethyl]carbamothioate |
| SMILES | NC(N)=NCCNC(=S)OCc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C14H16N4O3S/c15-13(16)17-5-6-18-14(22)20-8-10-7-9-3-1-2-4-11(9)21-12(10)19/h1-4,7H,5-6,8H2,(H,18,22)(H4,15,16,17) |
| InChIKey | XUSMNZMIJWHHJW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|