About 3-(2-bromoethyl)chromen-2-one;methanamine
3-(2-bromoethyl)chromen-2-one;methanamine (PubChem CID 175061055) has the molecular formula C12H14BrNO2
and a molecular weight of 284.15 g/mol. Its IUPAC name is 3-(2-bromoethyl)chromen-2-one;methanamine.
Molecular Properties
| Compound Name | 3-(2-bromoethyl)chromen-2-one;methanamine |
| PubChem CID | 175061055 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 3-(2-bromoethyl)chromen-2-one;methanamine |
| SMILES | CN.O=c1oc2ccccc2cc1CCBr |
| InChI | InChI=1S/C11H9BrO2.CH5N/c12-6-5-9-7-8-3-1-2-4-10(8)14-11(9)13;1-2/h1-4,7H,5-6H2;2H2,1H3 |
| InChIKey | BQUQBFGLLRBCDP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromoethyl)chromen-2-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromoethyl)chromen-2-one;methanamine?
The IUPAC name of 3-(2-bromoethyl)chromen-2-one;methanamine (CID 175061055) is 3-(2-bromoethyl)chromen-2-one;methanamine.
What is the SMILES notation for 3-(2-bromoethyl)chromen-2-one;methanamine?
The canonical SMILES for 3-(2-bromoethyl)chromen-2-one;methanamine is CN.O=c1oc2ccccc2cc1CCBr.
What is the InChIKey of 3-(2-bromoethyl)chromen-2-one;methanamine?
The InChIKey is BQUQBFGLLRBCDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO2.CH5N/c12-6-5-9-7-8-3-1-2-4-10(8)14-11(9)13;1-2/h1-4,7H,5-6H2;2H2,1H3.
What are the key properties of 3-(2-bromoethyl)chromen-2-one;methanamine?
3-(2-bromoethyl)chromen-2-one;methanamine has a molecular weight of 284.15 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromoethyl)chromen-2-one;methanamine is sourced from PubChem (CID 175061055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).