About N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen
N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen (PubChem CID 170712291) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen |
| PubChem CID | 170712291 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen |
| SMILES | CC(C)Cc1cc2ccccc2oc1=O.CNC(C)C.[H][H] |
| InChI | InChI=1S/C13H14O2.C4H11N.H2/c1-9(2)7-11-8-10-5-3-4-6-12(10)15-13(11)14;1-4(2)5-3;/h3-6,8-9H,7H2,1-2H3;4-5H,1-3H3;1H |
| InChIKey | IVJALHKEMMUCOI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen?
The IUPAC name of N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen (CID 170712291) is N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen.
What is the SMILES notation for N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen?
The canonical SMILES for N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen is CC(C)Cc1cc2ccccc2oc1=O.CNC(C)C.[H][H].
What is the InChIKey of N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen?
The InChIKey is IVJALHKEMMUCOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2.C4H11N.H2/c1-9(2)7-11-8-10-5-3-4-6-12(10)15-13(11)14;1-4(2)5-3;/h3-6,8-9H,7H2,1-2H3;4-5H,1-3H3;1H.
What are the key properties of N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen?
N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen has a molecular weight of 277.41 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-2-amine;3-(2-methylpropyl)chromen-2-one;molecular hydrogen is sourced from PubChem (CID 170712291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).