C12H12NO7PS — CID 167094653
O-[(2-oxochromen-3-yl)methyl] N-(phosphonooxymethyl)carbamothioate (PubChem CID 167094653) has the molecular formula C12H12NO7PS and a molecular weight of 345.27 g/mol. Its IUPAC name is O-[(2-oxochromen-3-yl)methyl] N-(phosphonooxymethyl)carbamothioate.
| Compound Name | O-[(2-oxochromen-3-yl)methyl] N-(phosphonooxymethyl)carbamothioate |
|---|---|
| PubChem CID | 167094653 |
| Molecular Formula | C12H12NO7PS |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | O-[(2-oxochromen-3-yl)methyl] N-(phosphonooxymethyl)carbamothioate |
| SMILES | O=c1oc2ccccc2cc1COC(=S)NCOP(=O)(O)O |
| InChI | InChI=1S/C12H12NO7PS/c14-11-9(5-8-3-1-2-4-10(8)20-11)6-18-12(22)13-7-19-21(15,16)17/h1-5H,6-7H2,(H,13,22)(H2,15,16,17) |
| InChIKey | AHQZTMDTWNWESM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|