C13H15N3O2S — CID 167094479
2-[2-[(2-oxochromen-3-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 167094479) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[2-[(2-oxochromen-3-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[(2-oxochromen-3-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 167094479 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[2-[(2-oxochromen-3-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | NC(N)=NCCSCc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H15N3O2S/c14-13(15)16-5-6-19-8-10-7-9-3-1-2-4-11(9)18-12(10)17/h1-4,7H,5-6,8H2,(H4,14,15,16) |
| InChIKey | FJGWTCKQFLDFEM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|