C10H15FIN3S — CID 110884483
2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine;hydroiodide (PubChem CID 110884483) has the molecular formula C10H15FIN3S and a molecular weight of 355.22 g/mol. Its IUPAC name is 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110884483 |
| Molecular Formula | C10H15FIN3S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCCSCc1ccccc1F |
| InChI | InChI=1S/C10H14FN3S.HI/c11-9-4-2-1-3-8(9)7-15-6-5-14-10(12)13;/h1-4H,5-7H2,(H4,12,13,14);1H |
| InChIKey | NKVISLKAJJNDAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|