C20H27FIN3O2S — CID 111200599
1-[(3,4-dimethoxyphenyl)methyl]-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111200599) has the molecular formula C20H27FIN3O2S and a molecular weight of 519.42 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111200599 |
| Molecular Formula | C20H27FIN3O2S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCSCc1ccccc1F)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C20H26FN3O2S.HI/c1-22-20(23-10-11-27-14-16-6-4-5-7-17(16)21)24-13-15-8-9-18(25-2)19(12-15)26-3;/h4-9,12H,10-11,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | LXJHRXPRCMLOCE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|