C18H22BrFIN3O — CID 111363148
1-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111363148) has the molecular formula C18H22BrFIN3O and a molecular weight of 522.20 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111363148 |
| Molecular Formula | C18H22BrFIN3O |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCc1ccc(OC)c(Br)c1.I |
| InChI | InChI=1S/C18H21BrFN3O.HI/c1-21-18(22-10-9-14-5-3-4-6-16(14)20)23-12-13-7-8-17(24-2)15(19)11-13;/h3-8,11H,9-10,12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | WBRVZILNLKEMIQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|