C16H24FN3O2S2 — CID 111141383
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine (PubChem CID 111141383) has the molecular formula C16H24FN3O2S2 and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111141383 |
| Molecular Formula | C16H24FN3O2S2 |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCSCc1ccccc1F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24FN3O2S2/c1-2-18-16(20-14-7-10-24(21,22)12-14)19-8-9-23-11-13-5-3-4-6-15(13)17/h3-6,14H,2,7-12H2,1H3,(H2,18,19,20) |
| InChIKey | LCSVXOSGMNJQSO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|