C16H22F3N3O2S — CID 111141149
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111141149) has the molecular formula C16H22F3N3O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111141149 |
| Molecular Formula | C16H22F3N3O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc(C(F)(F)F)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22F3N3O2S/c1-2-20-15(22-14-8-10-25(23,24)11-14)21-9-7-12-3-5-13(6-4-12)16(17,18)19/h3-6,14H,2,7-11H2,1H3,(H2,20,21,22) |
| InChIKey | LQIVRUSVPOCFPJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|