C17H24O8 — CID 26211058
[(E,2R,3S,6R,7S)-3-acetyloxy-7-hydroxy-6-methoxy-7-[(2S)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate (PubChem CID 26211058) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(E,2R,3S,6R,7S)-3-acetyloxy-7-hydroxy-6-methoxy-7-[(2S)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate.
| Compound Name | [(E,2R,3S,6R,7S)-3-acetyloxy-7-hydroxy-6-methoxy-7-[(2S)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 26211058 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(E,2R,3S,6R,7S)-3-acetyloxy-7-hydroxy-6-methoxy-7-[(2S)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
| SMILES | CO[C@H](/C=C/[C@H](OC(C)=O)[C@@H](C)OC(C)=O)[C@@H](O)[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C17H24O8/c1-10(23-11(2)18)13(24-12(3)19)8-9-14(22-4)17(21)15-6-5-7-16(20)25-15/h5,7-10,13-15,17,21H,6H2,1-4H3/b9-8+/t10-,13+,14-,15+,17-/m1/s1 |
| InChIKey | STNNWPKHRBGYMO-MFMCEQSCSA-N |
| XLogP | 0.67 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|