C13H14O4 — CID 118584259
2-[(1R)-1,2-dihydroxy-2-phenylethyl]-2,3-dihydropyran-6-one (PubChem CID 118584259) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[(1R)-1,2-dihydroxy-2-phenylethyl]-2,3-dihydropyran-6-one.
| Compound Name | 2-[(1R)-1,2-dihydroxy-2-phenylethyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 118584259 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-[(1R)-1,2-dihydroxy-2-phenylethyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC([C@H](O)C(O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H14O4/c14-11-8-4-7-10(17-11)13(16)12(15)9-5-2-1-3-6-9/h1-6,8,10,12-13,15-16H,7H2/t10?,12?,13-/m0/s1 |
| InChIKey | RTNQVKQMVIXUPZ-GDKBPFBDSA-N |
| XLogP | 0.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |