C23H27NO2 — CID 67588476
2-[1-(dibenzylamino)-2-methylpropyl]-2,3-dihydropyran-6-one (PubChem CID 67588476) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 2-[1-(dibenzylamino)-2-methylpropyl]-2,3-dihydropyran-6-one.
| Compound Name | 2-[1-(dibenzylamino)-2-methylpropyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 67588476 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-[1-(dibenzylamino)-2-methylpropyl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)C(C1CC=CC(=O)O1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-18(2)23(21-14-9-15-22(25)26-21)24(16-19-10-5-3-6-11-19)17-20-12-7-4-8-13-20/h3-13,15,18,21,23H,14,16-17H2,1-2H3 |
| InChIKey | LMOHDMDFHPWJTA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |