C33H33NO2 — CID 54208749
(3R,5S)-3-benzyl-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-2-one (PubChem CID 54208749) has the molecular formula C33H33NO2 and a molecular weight of 475.63 g/mol. Its IUPAC name is (3R,5S)-3-benzyl-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-2-one.
| Compound Name | (3R,5S)-3-benzyl-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-2-one |
|---|---|
| PubChem CID | 54208749 |
| Molecular Formula | C33H33NO2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (3R,5S)-3-benzyl-5-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-2-one |
| SMILES | O=C1O[C@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)C[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H33NO2/c35-33-30(21-26-13-5-1-6-14-26)23-32(36-33)31(22-27-15-7-2-8-16-27)34(24-28-17-9-3-10-18-28)25-29-19-11-4-12-20-29/h1-20,30-32H,21-25H2/t30-,31+,32+/m1/s1 |
| InChIKey | PUKOXRSCFYSWSN-RTOKGZNSSA-N |
| XLogP | 6.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |