C23H29NO2 — CID 141419745
(2S)-2-(dibenzylamino)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one (PubChem CID 141419745) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2S)-2-(dibenzylamino)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one.
| Compound Name | (2S)-2-(dibenzylamino)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 141419745 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2S)-2-(dibenzylamino)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one |
| SMILES | CC(C)C[C@@H](C(=O)[C@@]1(C)CO1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-18(2)14-21(22(25)23(3)17-26-23)24(15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20/h4-13,18,21H,14-17H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | USPXRIFDIULMKP-JTHBVZDNSA-N |
| XLogP | 4.46 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|