C11H18O4 — CID 101248046
(2S)-2-[(1S,2R)-1,2-dihydroxyhexyl]-2,3-dihydropyran-6-one (PubChem CID 101248046) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2S)-2-[(1S,2R)-1,2-dihydroxyhexyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(1S,2R)-1,2-dihydroxyhexyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101248046 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2S)-2-[(1S,2R)-1,2-dihydroxyhexyl]-2,3-dihydropyran-6-one |
| SMILES | CCCC[C@@H](O)[C@H](O)[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C11H18O4/c1-2-3-5-8(12)11(14)9-6-4-7-10(13)15-9/h4,7-9,11-12,14H,2-3,5-6H2,1H3/t8-,9+,11+/m1/s1 |
| InChIKey | NNTBVWFIJFDEPF-YWVKMMECSA-N |
| XLogP | 0.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |