C18H34O5Si — CID 11152561
(2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyheptyl]-2,3-dihydropyran-6-one (PubChem CID 11152561) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyheptyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyheptyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11152561 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyheptyl]-2,3-dihydropyran-6-one |
| SMILES | CCCC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C18H34O5Si/c1-7-8-10-13(19)16(21)17(14-11-9-12-15(20)22-14)23-24(5,6)18(2,3)4/h9,12-14,16-17,19,21H,7-8,10-11H2,1-6H3/t13-,14+,16+,17+/m0/s1 |
| InChIKey | ZOZVSXRZCZRHHN-XOSAIJSUSA-N |
| XLogP | 3.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|