C18H24O10 — CID 101267305
[(E,2S,3R,5S)-3,5-diacetyloxy-3-hydroxy-7-[(2S,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate (PubChem CID 101267305) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(E,2S,3R,5S)-3,5-diacetyloxy-3-hydroxy-7-[(2S,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate.
| Compound Name | [(E,2S,3R,5S)-3,5-diacetyloxy-3-hydroxy-7-[(2S,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 101267305 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(E,2S,3R,5S)-3,5-diacetyloxy-3-hydroxy-7-[(2S,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/[C@@H]1OC(=O)C=C[C@@H]1O)C[C@@](O)(OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C18H24O10/c1-10(25-11(2)19)18(24,28-13(4)21)9-14(26-12(3)20)5-7-16-15(22)6-8-17(23)27-16/h5-8,10,14-16,22,24H,9H2,1-4H3/b7-5+/t10-,14+,15-,16-,18+/m0/s1 |
| InChIKey | XPJKRRDFFPYURY-GJNHSSSJSA-N |
| XLogP | -0.09 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|